C18H21N2O2+ — CID 892705
(2S)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol (PubChem CID 892705) has the molecular formula C18H21N2O2+ and a molecular weight of 297.38 g/mol. Its IUPAC name is (2S)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 892705 |
| Molecular Formula | C18H21N2O2+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (2S)-1-(3-methylbenzimidazol-3-ium-1-yl)-3-(4-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(OC[C@@H](O)Cn2c[n+](C)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H21N2O2/c1-14-7-9-16(10-8-14)22-12-15(21)11-20-13-19(2)17-5-3-4-6-18(17)20/h3-10,13,15,21H,11-12H2,1-2H3/q+1/t15-/m0/s1 |
| InChIKey | RJUAOUKDLSIRGA-HNNXBMFYSA-N |
| XLogP | 2.21 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|