C20H25N2O2+ — CID 800573
(2S)-1-(2-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol (PubChem CID 800573) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is (2S)-1-(2-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol.
| Compound Name | (2S)-1-(2-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 800573 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2S)-1-(2-methylphenoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol |
| SMILES | Cc1cc2c(cc1C)[n+](C)cn2C[C@H](O)COc1ccccc1C |
| InChI | InChI=1S/C20H25N2O2/c1-14-7-5-6-8-20(14)24-12-17(23)11-22-13-21(4)18-9-15(2)16(3)10-19(18)22/h5-10,13,17,23H,11-12H2,1-4H3/q+1/t17-/m0/s1 |
| InChIKey | XUPJRJCGJBVUDH-KRWDZBQOSA-N |
| XLogP | 2.83 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|