About 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide
1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide (PubChem CID 126477001) has the molecular formula C19H23IN2O2
and a molecular weight of 438.31 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide.
Molecular Properties
| Compound Name | 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
| PubChem CID | 126477001 |
| Molecular Formula | C19H23IN2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
| SMILES | Cc1cccc(C)c1OCC(O)Cn1c[n+](C)c2ccccc21.[I-] |
| InChI | InChI=1S/C19H23N2O2.HI/c1-14-7-6-8-15(2)19(14)23-12-16(22)11-21-13-20(3)17-9-4-5-10-18(17)21;/h4-10,13,16,22H,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OXCMIWDBXHRAMW-UHFFFAOYSA-M |
| XLogP | -0.47 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide?
The IUPAC name of 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide (CID 126477001) is 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide.
What is the SMILES notation for 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide?
The canonical SMILES for 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide is Cc1cccc(C)c1OCC(O)Cn1c[n+](C)c2ccccc21.[I-].
What is the InChIKey of 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide?
The InChIKey is OXCMIWDBXHRAMW-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H23N2O2.HI/c1-14-7-6-8-15(2)19(14)23-12-16(22)11-21-13-20(3)17-9-4-5-10-18(17)21;/h4-10,13,16,22H,11-12H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide?
1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide has a molecular weight of 438.31 g/mol, XLogP of -0.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenoxy)-3-(3-methylbenzimidazol-3-ium-1-yl)propan-2-ol iodide is sourced from PubChem (CID 126477001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).