C24H26N3O2+ — CID 5128349
1-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-3-phenoxypropan-2-ol (PubChem CID 5128349) has the molecular formula C24H26N3O2+ and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-3-phenoxypropan-2-ol.
| Compound Name | 1-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 5128349 |
| Molecular Formula | C24H26N3O2+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[2-amino-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]-3-phenoxypropan-2-ol |
| SMILES | Cc1ccc(C[n+]2c(N)n(CC(O)COc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-18-11-13-19(14-12-18)15-26-22-9-5-6-10-23(22)27(24(26)25)16-20(28)17-29-21-7-3-2-4-8-21/h2-14,20,25,28H,15-17H2,1H3/p+1 |
| InChIKey | QFXRDIRBBPLBCV-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|