C18H21ClN3O2+ — CID 6948125
(2S)-1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol (PubChem CID 6948125) has the molecular formula C18H21ClN3O2+ and a molecular weight of 346.84 g/mol. Its IUPAC name is (2S)-1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol.
| Compound Name | (2S)-1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 6948125 |
| Molecular Formula | C18H21ClN3O2+ |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (2S)-1-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-3-(4-chlorophenoxy)propan-2-ol |
| SMILES | CCn1c(N)[n+](C[C@H](O)COc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H20ClN3O2/c1-2-21-16-5-3-4-6-17(16)22(18(21)20)11-14(23)12-24-15-9-7-13(19)8-10-15/h3-10,14,20,23H,2,11-12H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | KQSAGMZSPCTLJX-AWEZNQCLSA-O |
| XLogP | 2.62 |
| TPSA | 64.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|