C17H19ClN3O+ — CID 7308188
(1R)-2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-chlorophenyl)ethanol (PubChem CID 7308188) has the molecular formula C17H19ClN3O+ and a molecular weight of 316.81 g/mol. Its IUPAC name is (1R)-2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-chlorophenyl)ethanol.
| Compound Name | (1R)-2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 7308188 |
| Molecular Formula | C17H19ClN3O+ |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (1R)-2-(2-amino-3-ethylbenzimidazol-1-ium-1-yl)-1-(4-chlorophenyl)ethanol |
| SMILES | CCn1c(N)[n+](C[C@H](O)c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H18ClN3O/c1-2-20-14-5-3-4-6-15(14)21(17(20)19)11-16(22)12-7-9-13(18)10-8-12/h3-10,16,19,22H,2,11H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | ZSEPWAPGCKEZFW-INIZCTEOSA-O |
| XLogP | 2.92 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|