C20H19ClN3O2+ — CID 5038749
2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanol (PubChem CID 5038749) has the molecular formula C20H19ClN3O2+ and a molecular weight of 368.84 g/mol. Its IUPAC name is 2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanol.
| Compound Name | 2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 5038749 |
| Molecular Formula | C20H19ClN3O2+ |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]-1-(furan-2-yl)ethanol |
| SMILES | Nc1n(CC(O)c2ccco2)c2ccccc2[n+]1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O2/c21-15-9-7-14(8-10-15)12-23-16-4-1-2-5-17(16)24(20(23)22)13-18(25)19-6-3-11-26-19/h1-11,18,22,25H,12-13H2/p+1 |
| InChIKey | SLBPOUTXKRGMHU-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|