C17H17BrClN3O2 — CID 44655639
methyl 2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]acetate bromide (PubChem CID 44655639) has the molecular formula C17H17BrClN3O2 and a molecular weight of 410.70 g/mol. Its IUPAC name is methyl 2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]acetate bromide.
| Compound Name | methyl 2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]acetate bromide |
|---|---|
| PubChem CID | 44655639 |
| Molecular Formula | C17H17BrClN3O2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | methyl 2-[2-amino-3-[(4-chlorophenyl)methyl]benzimidazol-3-ium-1-yl]acetate bromide |
| SMILES | COC(=O)Cn1c(N)[n+](Cc2ccc(Cl)cc2)c2ccccc21.[Br-] |
| InChI | InChI=1S/C17H16ClN3O2.BrH/c1-23-16(22)11-21-15-5-3-2-4-14(15)20(17(21)19)10-12-6-8-13(18)9-7-12;/h2-9,19H,10-11H2,1H3;1H |
| InChIKey | BNRCUDASSFYECP-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 61.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|