C17H15ClN2O2S — CID 43814545
methyl 2-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetate (PubChem CID 43814545) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is methyl 2-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 43814545 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | methyl 2-[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1nc2ccccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O2S/c1-22-16(21)11-23-17-19-14-4-2-3-5-15(14)20(17)10-12-6-8-13(18)9-7-12/h2-9H,10-11H2,1H3 |
| InChIKey | SZEUDHCAXYSLSW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |