C16H19N3O3S — CID 4085274
methyl 2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)benzimidazol-2-yl]sulfanylacetate (PubChem CID 4085274) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is methyl 2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)benzimidazol-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)benzimidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 4085274 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | methyl 2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)benzimidazol-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1nc2ccccc2n1CC(=O)N1CCCC1 |
| InChI | InChI=1S/C16H19N3O3S/c1-22-15(21)11-23-16-17-12-6-2-3-7-13(12)19(16)10-14(20)18-8-4-5-9-18/h2-3,6-7H,4-5,8-11H2,1H3 |
| InChIKey | KRQPRCGHRYGLSP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |