C18H23N3O3S — CID 7246530
methyl 1-[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate (PubChem CID 7246530) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is methyl 1-[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7246530 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | methyl 1-[2-(1-ethylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate |
| SMILES | CCn1c(SCC(=O)N2CCC(C(=O)OC)CC2)nc2ccccc21 |
| InChI | InChI=1S/C18H23N3O3S/c1-3-21-15-7-5-4-6-14(15)19-18(21)25-12-16(22)20-10-8-13(9-11-20)17(23)24-2/h4-7,13H,3,8-12H2,1-2H3 |
| InChIKey | ISVCCPVKKKBVNY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |