C20H27N3O3S — CID 4692366
1-[2-(1-pentylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylic acid (PubChem CID 4692366) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[2-(1-pentylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(1-pentylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4692366 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-[2-(1-pentylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylic acid |
| SMILES | CCCCCn1c(SCC(=O)N2CCC(C(=O)O)CC2)nc2ccccc21 |
| InChI | InChI=1S/C20H27N3O3S/c1-2-3-6-11-23-17-8-5-4-7-16(17)21-20(23)27-14-18(24)22-12-9-15(10-13-22)19(25)26/h4-5,7-8,15H,2-3,6,9-14H2,1H3,(H,25,26) |
| InChIKey | MHTLJGSLNHDOIW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|