C25H29N3O3S — CID 5221721
ethyl 1-[2-[1-(2-phenylethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxylate (PubChem CID 5221721) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is ethyl 1-[2-[1-(2-phenylethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[1-(2-phenylethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 5221721 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | ethyl 1-[2-[1-(2-phenylethyl)benzimidazol-2-yl]sulfanylacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CSc2nc3ccccc3n2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N3O3S/c1-2-31-24(30)20-13-15-27(16-14-20)23(29)18-32-25-26-21-10-6-7-11-22(21)28(25)17-12-19-8-4-3-5-9-19/h3-11,20H,2,12-18H2,1H3 |
| InChIKey | MAERZAZTHGXFII-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |