C19H23N3O3S — CID 7145614
ethyl 1-[2-(2-methylquinazolin-4-yl)sulfanylacetyl]piperidine-4-carboxylate (PubChem CID 7145614) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is ethyl 1-[2-(2-methylquinazolin-4-yl)sulfanylacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(2-methylquinazolin-4-yl)sulfanylacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7145614 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | ethyl 1-[2-(2-methylquinazolin-4-yl)sulfanylacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CSc2nc(C)nc3ccccc23)CC1 |
| InChI | InChI=1S/C19H23N3O3S/c1-3-25-19(24)14-8-10-22(11-9-14)17(23)12-26-18-15-6-4-5-7-16(15)20-13(2)21-18/h4-7,14H,3,8-12H2,1-2H3 |
| InChIKey | PAPBZQCHYUMNTR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |