C22H23N3O3S — CID 17455806
methyl 1-[2-(1-phenylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate (PubChem CID 17455806) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is methyl 1-[2-(1-phenylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(1-phenylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 17455806 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 1-[2-(1-phenylbenzimidazol-2-yl)sulfanylacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CSc2nc3ccccc3n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23N3O3S/c1-28-21(27)16-11-13-24(14-12-16)20(26)15-29-22-23-18-9-5-6-10-19(18)25(22)17-7-3-2-4-8-17/h2-10,16H,11-15H2,1H3 |
| InChIKey | YFUCMJYZBDRRRO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |