C21H23FN4OS — CID 40673693
2-(1-ethylbenzimidazol-2-yl)sulfanyl-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 40673693) has the molecular formula C21H23FN4OS and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-(1-ethylbenzimidazol-2-yl)sulfanyl-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 40673693 |
| Molecular Formula | C21H23FN4OS |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | CCn1c(SCC(=O)N2CCN(c3ccccc3F)CC2)nc2ccccc21 |
| InChI | InChI=1S/C21H23FN4OS/c1-2-26-19-10-6-4-8-17(19)23-21(26)28-15-20(27)25-13-11-24(12-14-25)18-9-5-3-7-16(18)22/h3-10H,2,11-15H2,1H3 |
| InChIKey | HPCAADTXBYHOJB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |