C34H34N3O2+ — CID 44552548
methyl (E)-3-anilino-3-[1,3-bis[(4-methylphenyl)methyl]benzimidazol-3-ium-2-yl]-2-methylprop-2-enoate (PubChem CID 44552548) has the molecular formula C34H34N3O2+ and a molecular weight of 516.67 g/mol. Its IUPAC name is methyl (E)-3-anilino-3-[1,3-bis[(4-methylphenyl)methyl]benzimidazol-3-ium-2-yl]-2-methylprop-2-enoate.
| Compound Name | methyl (E)-3-anilino-3-[1,3-bis[(4-methylphenyl)methyl]benzimidazol-3-ium-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 44552548 |
| Molecular Formula | C34H34N3O2+ |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | methyl (E)-3-anilino-3-[1,3-bis[(4-methylphenyl)methyl]benzimidazol-3-ium-2-yl]-2-methylprop-2-enoate |
| SMILES | COC(=O)/C(C)=C(/Nc1ccccc1)c1n(Cc2ccc(C)cc2)c2ccccc2[n+]1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C34H33N3O2/c1-24-14-18-27(19-15-24)22-36-30-12-8-9-13-31(30)37(23-28-20-16-25(2)17-21-28)33(36)32(26(3)34(38)39-4)35-29-10-6-5-7-11-29/h5-21H,22-23H2,1-4H3/p+1 |
| InChIKey | HHLCZAOKRFLVAQ-UHFFFAOYSA-O |
| XLogP | 6.66 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|