C22H26BrN3O2 — CID 44552541
methyl (E)-3-anilino-3-(1,3-diethylbenzimidazol-3-ium-2-yl)-2-methylprop-2-enoate bromide (PubChem CID 44552541) has the molecular formula C22H26BrN3O2 and a molecular weight of 444.37 g/mol. Its IUPAC name is methyl (E)-3-anilino-3-(1,3-diethylbenzimidazol-3-ium-2-yl)-2-methylprop-2-enoate bromide.
| Compound Name | methyl (E)-3-anilino-3-(1,3-diethylbenzimidazol-3-ium-2-yl)-2-methylprop-2-enoate bromide |
|---|---|
| PubChem CID | 44552541 |
| Molecular Formula | C22H26BrN3O2 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | methyl (E)-3-anilino-3-(1,3-diethylbenzimidazol-3-ium-2-yl)-2-methylprop-2-enoate bromide |
| SMILES | CCn1c(/C(Nc2ccccc2)=C(/C)C(=O)OC)[n+](CC)c2ccccc21.[Br-] |
| InChI | InChI=1S/C22H25N3O2.BrH/c1-5-24-18-14-10-11-15-19(18)25(6-2)21(24)20(16(3)22(26)27-4)23-17-12-8-7-9-13-17;/h7-15H,5-6H2,1-4H3;1H |
| InChIKey | IEAPIZVNCBXAKB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|