C17H20ClIN6O2 — CID 53257775
(1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide (PubChem CID 53257775) has the molecular formula C17H20ClIN6O2 and a molecular weight of 502.74 g/mol. Its IUPAC name is (1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide.
| Compound Name | (1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide |
|---|---|
| PubChem CID | 53257775 |
| Molecular Formula | C17H20ClIN6O2 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | (1,3-diethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide |
| SMILES | CCn1c(COC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccccc21.[I-] |
| InChI | InChI=1S/C17H19ClN6O2.HI/c1-3-23-10-7-5-6-8-11(10)24(4-2)12(23)9-26-17(25)13-15(19)22-16(20)14(18)21-13;/h5-8H,3-4,9H2,1-2H3,(H3-,19,20,22,25);1H |
| InChIKey | FSAVRYZMQKFOGX-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|