C18H19ClN7O2+ — CID 53257900
(5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate (PubChem CID 53257900) has the molecular formula C18H19ClN7O2+ and a molecular weight of 400.85 g/mol. Its IUPAC name is (5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate.
| Compound Name | (5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
|---|---|
| PubChem CID | 53257900 |
| Molecular Formula | C18H19ClN7O2+ |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
| SMILES | CCn1c(COC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C18H18ClN7O2/c1-3-25-11-6-5-10(8-20)7-12(11)26(4-2)13(25)9-28-18(27)14-16(21)24-17(22)15(19)23-14/h5-7H,3-4,9H2,1-2H3,(H3-,21,22,24,27)/p+1 |
| InChIKey | DVOITTUPEATDPM-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|