C18H19ClIN7O2 — CID 53257899
(5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide (PubChem CID 53257899) has the molecular formula C18H19ClIN7O2 and a molecular weight of 527.75 g/mol. Its IUPAC name is (5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide.
| Compound Name | (5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide |
|---|---|
| PubChem CID | 53257899 |
| Molecular Formula | C18H19ClIN7O2 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | (5-cyano-1,3-diethylbenzimidazol-1-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide |
| SMILES | CCn1c(COC(=O)c2nc(Cl)c(N)nc2N)[n+](CC)c2ccc(C#N)cc21.[I-] |
| InChI | InChI=1S/C18H18ClN7O2.HI/c1-3-25-11-6-5-10(8-20)7-12(11)26(4-2)13(25)9-28-18(27)14-16(21)24-17(22)15(19)23-14;/h5-7H,3-4,9H2,1-2H3,(H3-,21,22,24,27);1H |
| InChIKey | LIQOUCLMNQNLLD-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|