C12H17BF4N2 — CID 13449953
1,3-diethyl-2-methylbenzimidazol-3-ium tetrafluoroborate (PubChem CID 13449953) has the molecular formula C12H17BF4N2 and a molecular weight of 276.09 g/mol. Its IUPAC name is 1,3-diethyl-2-methylbenzimidazol-3-ium tetrafluoroborate.
| Compound Name | 1,3-diethyl-2-methylbenzimidazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 13449953 |
| Molecular Formula | C12H17BF4N2 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1,3-diethyl-2-methylbenzimidazol-3-ium tetrafluoroborate |
| SMILES | CCn1c(C)[n+](CC)c2ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C12H17N2.BF4/c1-4-13-10(3)14(5-2)12-9-7-6-8-11(12)13;2-1(3,4)5/h6-9H,4-5H2,1-3H3;/q+1;-1 |
| InChIKey | YNSCFXUJCCGMCA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|