C16H26N3+ — CID 15333592
N,N,1,3-tetraethyl-2-methylbenzimidazol-1-ium-5-amine (PubChem CID 15333592) has the molecular formula C16H26N3+ and a molecular weight of 260.40 g/mol. Its IUPAC name is N,N,1,3-tetraethyl-2-methylbenzimidazol-1-ium-5-amine.
| Compound Name | N,N,1,3-tetraethyl-2-methylbenzimidazol-1-ium-5-amine |
|---|---|
| PubChem CID | 15333592 |
| Molecular Formula | C16H26N3+ |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | N,N,1,3-tetraethyl-2-methylbenzimidazol-1-ium-5-amine |
| SMILES | CCN(CC)c1ccc2c(c1)n(CC)c(C)[n+]2CC |
| InChI | InChI=1S/C16H26N3/c1-6-17(7-2)14-10-11-15-16(12-14)19(9-4)13(5)18(15)8-3/h10-12H,6-9H2,1-5H3/q+1 |
| InChIKey | WBQZUFMKCZSLER-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|