C28H31N4S2+ — CID 58659779
N,N-diethyl-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]aniline (PubChem CID 58659779) has the molecular formula C28H31N4S2+ and a molecular weight of 487.72 g/mol. Its IUPAC name is N,N-diethyl-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]aniline.
| Compound Name | N,N-diethyl-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]aniline |
|---|---|
| PubChem CID | 58659779 |
| Molecular Formula | C28H31N4S2+ |
| Molecular Weight | 487.72 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N,N-diethyl-4-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-3-[(3-ethyl-1,3-benzothiazol-2-ylidene)amino]aniline |
| SMILES | CCN(CC)c1ccc(-c2sc3ccccc3[n+]2CC)c(/N=c2\sc3ccccc3n2CC)c1 |
| InChI | InChI=1S/C28H31N4S2/c1-5-30(6-2)20-17-18-21(27-31(7-3)23-13-9-11-15-25(23)33-27)22(19-20)29-28-32(8-4)24-14-10-12-16-26(24)34-28/h9-19H,5-8H2,1-4H3/q+1 |
| InChIKey | QMIFASRRBKICSG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 24.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|