C24H26N3O2S+ — CID 123607433
3-[2-[3-(2-aminoethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one (PubChem CID 123607433) has the molecular formula C24H26N3O2S+ and a molecular weight of 420.56 g/mol. Its IUPAC name is 3-[2-[3-(2-aminoethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one.
| Compound Name | 3-[2-[3-(2-aminoethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one |
|---|---|
| PubChem CID | 123607433 |
| Molecular Formula | C24H26N3O2S+ |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3-[2-[3-(2-aminoethyl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3sc4ccccc4[n+]3CCN)c(=O)oc2c1 |
| InChI | InChI=1S/C24H26N3O2S/c1-3-26(4-2)19-11-9-17-15-18(24(28)29-21(17)16-19)10-12-23-27(14-13-25)20-7-5-6-8-22(20)30-23/h5-12,15-16H,3-4,13-14,25H2,1-2H3/q+1 |
| InChIKey | UEWBCVITHXYEJO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|