C16H19N2O2+ — CID 166593954
[(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]prop-2-enylidene]azanium (PubChem CID 166593954) has the molecular formula C16H19N2O2+ and a molecular weight of 271.34 g/mol. Its IUPAC name is [(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]prop-2-enylidene]azanium.
| Compound Name | [(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 166593954 |
| Molecular Formula | C16H19N2O2+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | [(E)-3-[7-(diethylamino)-2-oxochromen-3-yl]prop-2-enylidene]azanium |
| SMILES | CCN(CC)c1ccc2cc(/C=C/C=[NH2+])c(=O)oc2c1 |
| InChI | InChI=1S/C16H18N2O2/c1-3-18(4-2)14-8-7-12-10-13(6-5-9-17)16(19)20-15(12)11-14/h5-11,17H,3-4H2,1-2H3/p+1/b6-5+,17-9? |
| InChIKey | FVRBVOYJTIUTSF-WCLBPFOISA-O |
| XLogP | 1.48 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|