C23H24N2O3 — CID 154160475
7-(diethylamino)-3-[(E)-2-(3-methyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one (PubChem CID 154160475) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 7-(diethylamino)-3-[(E)-2-(3-methyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[(E)-2-(3-methyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one |
|---|---|
| PubChem CID | 154160475 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 7-(diethylamino)-3-[(E)-2-(3-methyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(/C=C/C3Oc4ccccc4N3C)c(=O)oc2c1 |
| InChI | InChI=1S/C23H24N2O3/c1-4-25(5-2)18-12-10-16-14-17(23(26)28-21(16)15-18)11-13-22-24(3)19-8-6-7-9-20(19)27-22/h6-15,22H,4-5H2,1-3H3/b13-11+ |
| InChIKey | LMDXXYHKXDATOF-ACCUITESSA-N |
| XLogP | 4.51 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|