C25H24N2O3 — CID 118420708
7-(diethylamino)-3-[(E)-2-(3-prop-2-ynyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one (PubChem CID 118420708) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 7-(diethylamino)-3-[(E)-2-(3-prop-2-ynyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one.
| Compound Name | 7-(diethylamino)-3-[(E)-2-(3-prop-2-ynyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one |
|---|---|
| PubChem CID | 118420708 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 7-(diethylamino)-3-[(E)-2-(3-prop-2-ynyl-2H-1,3-benzoxazol-2-yl)ethenyl]chromen-2-one |
| SMILES | C#CCN1c2ccccc2OC1/C=C/c1cc2ccc(N(CC)CC)cc2oc1=O |
| InChI | InChI=1S/C25H24N2O3/c1-4-15-27-21-9-7-8-10-22(21)29-24(27)14-12-19-16-18-11-13-20(26(5-2)6-3)17-23(18)30-25(19)28/h1,7-14,16-17,24H,5-6,15H2,2-3H3/b14-12+ |
| InChIKey | DRLKVMULXNYRKN-WYMLVPIESA-N |
| XLogP | 4.51 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|