C24H27IN3O3+ — CID 74404268
N-[2-[4-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]ethyl]-2-iodoacetamide (PubChem CID 74404268) has the molecular formula C24H27IN3O3+ and a molecular weight of 532.40 g/mol. Its IUPAC name is N-[2-[4-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]ethyl]-2-iodoacetamide.
| Compound Name | N-[2-[4-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]ethyl]-2-iodoacetamide |
|---|---|
| PubChem CID | 74404268 |
| Molecular Formula | C24H27IN3O3+ |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | N-[2-[4-[2-[7-(diethylamino)-2-oxochromen-3-yl]ethenyl]pyridin-1-ium-1-yl]ethyl]-2-iodoacetamide |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3cc[n+](CCNC(=O)CI)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H26IN3O3/c1-3-28(4-2)21-8-7-19-15-20(24(30)31-22(19)16-21)6-5-18-9-12-27(13-10-18)14-11-26-23(29)17-25/h5-10,12-13,15-16H,3-4,11,14,17H2,1-2H3/p+1 |
| InChIKey | FCIVFGQZQVLGHS-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|