C26H28BrN2O2S+ — CID 123465645
3-[2-[3-(3-bromobutan-2-yl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one (PubChem CID 123465645) has the molecular formula C26H28BrN2O2S+ and a molecular weight of 512.49 g/mol. Its IUPAC name is 3-[2-[3-(3-bromobutan-2-yl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one.
| Compound Name | 3-[2-[3-(3-bromobutan-2-yl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one |
|---|---|
| PubChem CID | 123465645 |
| Molecular Formula | C26H28BrN2O2S+ |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | 3-[2-[3-(3-bromobutan-2-yl)-1,3-benzothiazol-3-ium-2-yl]ethenyl]-7-(diethylamino)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(C=Cc3sc4ccccc4[n+]3C(C)C(C)Br)c(=O)oc2c1 |
| InChI | InChI=1S/C26H28BrN2O2S/c1-5-28(6-2)21-13-11-19-15-20(26(30)31-23(19)16-21)12-14-25-29(18(4)17(3)27)22-9-7-8-10-24(22)32-25/h7-18H,5-6H2,1-4H3/q+1 |
| InChIKey | RRBBPNSARVOBFX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|