C21H19N2O2S+ — CID 123890842
7-(dimethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one (PubChem CID 123890842) has the molecular formula C21H19N2O2S+ and a molecular weight of 363.46 g/mol. Its IUPAC name is 7-(dimethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one.
| Compound Name | 7-(dimethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one |
|---|---|
| PubChem CID | 123890842 |
| Molecular Formula | C21H19N2O2S+ |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 7-(dimethylamino)-3-[2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]chromen-2-one |
| SMILES | CN(C)c1ccc2cc(C=Cc3sc4ccccc4[n+]3C)c(=O)oc2c1 |
| InChI | InChI=1S/C21H19N2O2S/c1-22(2)16-10-8-14-12-15(21(24)25-18(14)13-16)9-11-20-23(3)17-6-4-5-7-19(17)26-20/h4-13H,1-3H3/q+1 |
| InChIKey | USVWLPGLRBZGGQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|