C24H23N2OS+ — CID 25136678
N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline (PubChem CID 25136678) has the molecular formula C24H23N2OS+ and a molecular weight of 387.53 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 25136678 |
| Molecular Formula | C24H23N2OS+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[5-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]furan-2-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(/C=C/c3sc4ccccc4[n+]3C)o2)cc1 |
| InChI | InChI=1S/C24H23N2OS/c1-25(2)19-11-8-18(9-12-19)10-13-20-14-15-21(27-20)16-17-24-26(3)22-6-4-5-7-23(22)28-24/h4-17H,1-3H3/q+1 |
| InChIKey | FYGGCIDOIWNRBM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|