C20H23N2OS+ — CID 177467082
2-[N-ethyl-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]ethanol (PubChem CID 177467082) has the molecular formula C20H23N2OS+ and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]ethanol.
| Compound Name | 2-[N-ethyl-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]ethanol |
|---|---|
| PubChem CID | 177467082 |
| Molecular Formula | C20H23N2OS+ |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[N-ethyl-4-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/C=C/c2sc3ccccc3[n+]2C)cc1 |
| InChI | InChI=1S/C20H23N2OS/c1-3-22(14-15-23)17-11-8-16(9-12-17)10-13-20-21(2)18-6-4-5-7-19(18)24-20/h4-13,23H,3,14-15H2,1-2H3/q+1 |
| InChIKey | CDJCUBWPKKVBQP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|