C25H30N3O4S2+ — CID 76577055
S-[2-[[2-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetyl]amino]ethyl] ethanethioate (PubChem CID 76577055) has the molecular formula C25H30N3O4S2+ and a molecular weight of 500.67 g/mol. Its IUPAC name is S-[2-[[2-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetyl]amino]ethyl] ethanethioate.
| Compound Name | S-[2-[[2-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetyl]amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 76577055 |
| Molecular Formula | C25H30N3O4S2+ |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | S-[2-[[2-[2-[2-[4-[bis(2-hydroxyethyl)amino]phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]acetyl]amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCNC(=O)C[n+]1c(C=Cc2ccc(N(CCO)CCO)cc2)sc2ccccc21 |
| InChI | InChI=1S/C25H29N3O4S2/c1-19(31)33-17-12-26-24(32)18-28-22-4-2-3-5-23(22)34-25(28)11-8-20-6-9-21(10-7-20)27(13-15-29)14-16-30/h2-11,29-30H,12-18H2,1H3/p+1 |
| InChIKey | PYKUNGBBLBJQSP-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|