C22H26N4S2 — CID 59950323
(E)-3-butyl-N-[(Z)-(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-imine (PubChem CID 59950323) has the molecular formula C22H26N4S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is (E)-3-butyl-N-[(Z)-(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-imine.
| Compound Name | (E)-3-butyl-N-[(Z)-(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 59950323 |
| Molecular Formula | C22H26N4S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (E)-3-butyl-N-[(Z)-(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-imine |
| SMILES | CCCCn1/c(=N/N=c2/sc3ccccc3n2CCCC)sc2ccccc21 |
| InChI | InChI=1S/C22H26N4S2/c1-3-5-15-25-17-11-7-9-13-19(17)27-21(25)23-24-22-26(16-6-4-2)18-12-8-10-14-20(18)28-22/h7-14H,3-6,15-16H2,1-2H3/b23-21-,24-22+ |
| InChIKey | AYCDGDBWPFNFKP-MMUCEYJRSA-N |
| XLogP | 5.74 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|