C19H19BrN4S2 — CID 72600489
N-[[3-(4-bromobutyl)-1,3-benzothiazol-2-ylidene]amino]-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 72600489) has the molecular formula C19H19BrN4S2 and a molecular weight of 447.43 g/mol. Its IUPAC name is N-[[3-(4-bromobutyl)-1,3-benzothiazol-2-ylidene]amino]-3-methyl-1,3-benzothiazol-2-imine.
| Compound Name | N-[[3-(4-bromobutyl)-1,3-benzothiazol-2-ylidene]amino]-3-methyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 72600489 |
| Molecular Formula | C19H19BrN4S2 |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | N-[[3-(4-bromobutyl)-1,3-benzothiazol-2-ylidene]amino]-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | Cn1c(=NN=c2sc3ccccc3n2CCCCBr)sc2ccccc21 |
| InChI | InChI=1S/C19H19BrN4S2/c1-23-14-8-2-4-10-16(14)25-18(23)21-22-19-24(13-7-6-12-20)15-9-3-5-11-17(15)26-19/h2-5,8-11H,6-7,12-13H2,1H3 |
| InChIKey | HGVRIGROTOQKRO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|