C16H15N3S — CID 6898197
(E)-3-methyl-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazol-2-imine (PubChem CID 6898197) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (E)-3-methyl-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazol-2-imine.
| Compound Name | (E)-3-methyl-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 6898197 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (E)-3-methyl-N-[(E)-(4-methylphenyl)methylideneamino]-1,3-benzothiazol-2-imine |
| SMILES | Cc1ccc(/C=N/N=c2/sc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C16H15N3S/c1-12-7-9-13(10-8-12)11-17-18-16-19(2)14-5-3-4-6-15(14)20-16/h3-11H,1-2H3/b17-11+,18-16+ |
| InChIKey | GGASVKTUFUGKHK-YLUJPUDGSA-N |
| XLogP | 3.48 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|