C23H29N3OS — CID 136758778
2,6-ditert-butyl-4-[(Z)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol (PubChem CID 136758778) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(Z)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(Z)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136758778 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2,6-ditert-butyl-4-[(Z)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol |
| SMILES | Cn1/c(=N/N=C\c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)sc2ccccc21 |
| InChI | InChI=1S/C23H29N3OS/c1-22(2,3)16-12-15(13-17(20(16)27)23(4,5)6)14-24-25-21-26(7)18-10-8-9-11-19(18)28-21/h8-14,27H,1-7H3/b24-14-,25-21- |
| InChIKey | SCTIVTUCVJMYLR-MGEGFMFESA-N |
| XLogP | 5.48 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|