C16H13N3O2S — CID 6903912
2-[(E)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoic acid (PubChem CID 6903912) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-[(E)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 6903912 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[(E)-[(E)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]benzoic acid |
| SMILES | Cn1/c(=N\N=C\c2ccccc2C(=O)O)sc2ccccc21 |
| InChI | InChI=1S/C16H13N3O2S/c1-19-13-8-4-5-9-14(13)22-16(19)18-17-10-11-6-2-3-7-12(11)15(20)21/h2-10H,1H3,(H,20,21)/b17-10+,18-16+ |
| InChIKey | ILNDGJBAJFOIBE-NSDISPIVSA-N |
| XLogP | 2.87 |
| TPSA | 66.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|