C15H11Br2N3OS — CID 135615987
2,6-dibromo-4-[(E)-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol (PubChem CID 135615987) has the molecular formula C15H11Br2N3OS and a molecular weight of 441.15 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(E)-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135615987 |
| Molecular Formula | C15H11Br2N3OS |
| Molecular Weight | 441.15 g/mol |
| Exact Mass | 438.90 |
| IUPAC Name | 2,6-dibromo-4-[(E)-[(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenol |
| SMILES | Cn1c(=N/N=C/c2cc(Br)c(O)c(Br)c2)sc2ccccc21 |
| InChI | InChI=1S/C15H11Br2N3OS/c1-20-12-4-2-3-5-13(12)22-15(20)19-18-8-9-6-10(16)14(21)11(17)7-9/h2-8,21H,1H3/b18-8+,19-15? |
| InChIKey | CALZKEOKJCVVMX-ZYHKQNKNSA-N |
| XLogP | 4.41 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.15 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|