C14H12N4S — CID 6904562
(Z)-3-methyl-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3-benzothiazol-2-imine (PubChem CID 6904562) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is (Z)-3-methyl-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3-benzothiazol-2-imine.
| Compound Name | (Z)-3-methyl-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 6904562 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (Z)-3-methyl-N-[(Z)-pyridin-2-ylmethylideneamino]-1,3-benzothiazol-2-imine |
| SMILES | Cn1/c(=N/N=C\c2ccccn2)sc2ccccc21 |
| InChI | InChI=1S/C14H12N4S/c1-18-12-7-2-3-8-13(12)19-14(18)17-16-10-11-6-4-5-9-15-11/h2-10H,1H3/b16-10-,17-14- |
| InChIKey | UXZPTGQYQYBVQO-RLAURGBNSA-N |
| XLogP | 2.57 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|