C22H21N5OS2 — CID 6902132
(E)-3-methyl-N-[(E)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzothiazol-2-imine (PubChem CID 6902132) has the molecular formula C22H21N5OS2 and a molecular weight of 435.58 g/mol. Its IUPAC name is (E)-3-methyl-N-[(E)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzothiazol-2-imine.
| Compound Name | (E)-3-methyl-N-[(E)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 6902132 |
| Molecular Formula | C22H21N5OS2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (E)-3-methyl-N-[(E)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]-1,3-benzothiazol-2-imine |
| SMILES | Cn1/c(=N/N=C/c2sc(N3CCOCC3)nc2-c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C22H21N5OS2/c1-26-17-9-5-6-10-18(17)29-22(26)25-23-15-19-20(16-7-3-2-4-8-16)24-21(30-19)27-11-13-28-14-12-27/h2-10,15H,11-14H2,1H3/b23-15+,25-22- |
| InChIKey | NXPGCTFLUHULKJ-SMKLJPHJSA-N |
| XLogP | 4.13 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|