C21H21N3OS — CID 73345964
(Z)-1-(4-morpholin-4-ylphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)ethanimine (PubChem CID 73345964) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is (Z)-1-(4-morpholin-4-ylphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)ethanimine.
| Compound Name | (Z)-1-(4-morpholin-4-ylphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)ethanimine |
|---|---|
| PubChem CID | 73345964 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (Z)-1-(4-morpholin-4-ylphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)ethanimine |
| SMILES | C/C(=N/c1nc(-c2ccccc2)cs1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H21N3OS/c1-16(17-7-9-19(10-8-17)24-11-13-25-14-12-24)22-21-23-20(15-26-21)18-5-3-2-4-6-18/h2-10,15H,11-14H2,1H3/b22-16- |
| InChIKey | BCCMOEKGVLNJHQ-JWGURIENSA-N |
| XLogP | 4.79 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|