C17H22N2OS — CID 174341504
4-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 174341504) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 4-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 174341504 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | CC(C)(C)c1ccc(-c2csc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C17H22N2OS/c1-17(2,3)14-6-4-13(5-7-14)15-12-21-16(18-15)19-8-10-20-11-9-19/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | IPEPXKKUHOGXLY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |