C24H28N4O3S — CID 16555935
2-[2-ethoxy-4-[(E)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone (PubChem CID 16555935) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-ethoxy-4-[(E)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 16555935 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]phenoxy]-1-piperidin-1-ylethanone |
| SMILES | CCOc1cc(/C=N/N=c2\sc3ccccc3n2C)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H28N4O3S/c1-3-30-21-15-18(11-12-20(21)31-17-23(29)28-13-7-4-8-14-28)16-25-26-24-27(2)19-9-5-6-10-22(19)32-24/h5-6,9-12,15-16H,3-4,7-8,13-14,17H2,1-2H3/b25-16+,26-24- |
| InChIKey | LIVKGTXVBGVOKN-YJBIHYNGSA-N |
| XLogP | 3.96 |
| TPSA | 68.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|