C14H10ClN5S2 — CID 8900414
(Z)-N-[(Z)-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-3-methyl-1,3-benzothiazol-2-imine (PubChem CID 8900414) has the molecular formula C14H10ClN5S2 and a molecular weight of 347.86 g/mol. Its IUPAC name is (Z)-N-[(Z)-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-3-methyl-1,3-benzothiazol-2-imine.
| Compound Name | (Z)-N-[(Z)-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-3-methyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 8900414 |
| Molecular Formula | C14H10ClN5S2 |
| Molecular Weight | 347.86 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (Z)-N-[(Z)-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-3-methyl-1,3-benzothiazol-2-imine |
| SMILES | Cn1/c(=N\N=C/c2c(Cl)nc3sccn23)sc2ccccc21 |
| InChI | InChI=1S/C14H10ClN5S2/c1-19-9-4-2-3-5-11(9)22-14(19)18-16-8-10-12(15)17-13-20(10)6-7-21-13/h2-8H,1H3/b16-8-,18-14+ |
| InChIKey | ZXFVKNMNGASENP-JHADWBBOSA-N |
| XLogP | 3.54 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|