C23H22ClN5S — CID 2446974
N-(4-benzhydrylpiperazin-1-yl)-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methanimine (PubChem CID 2446974) has the molecular formula C23H22ClN5S and a molecular weight of 435.98 g/mol. Its IUPAC name is N-(4-benzhydrylpiperazin-1-yl)-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methanimine.
| Compound Name | N-(4-benzhydrylpiperazin-1-yl)-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methanimine |
|---|---|
| PubChem CID | 2446974 |
| Molecular Formula | C23H22ClN5S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-(4-benzhydrylpiperazin-1-yl)-1-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methanimine |
| SMILES | Clc1nc2sccn2c1C=NN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H22ClN5S/c24-22-20(29-15-16-30-23(29)26-22)17-25-28-13-11-27(12-14-28)21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,15-17,21H,11-14H2 |
| InChIKey | XQTGCZUZXPNZNE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|