C17H13ClN4OS — CID 8861671
(E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 8861671) has the molecular formula C17H13ClN4OS and a molecular weight of 356.84 g/mol. Its IUPAC name is (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 8861671 |
| Molecular Formula | C17H13ClN4OS |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (E)-3-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C/c1c(Cl)nc2sccn12)c1ccccc1 |
| InChI | InChI=1S/C17H13ClN4OS/c1-11(12-5-3-2-4-6-12)20-16(23)13(10-19)9-14-15(18)21-17-22(14)7-8-24-17/h2-9,11H,1H3,(H,20,23)/b13-9+/t11-/m1/s1 |
| InChIKey | YBTYKNOGDNLTFA-VSXLWIIGSA-N |
| XLogP | 3.83 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|