C10H7N3O2S — CID 43244886
(E)-2-cyano-3-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid (PubChem CID 43244886) has the molecular formula C10H7N3O2S and a molecular weight of 233.25 g/mol. Its IUPAC name is (E)-2-cyano-3-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 43244886 |
| Molecular Formula | C10H7N3O2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | (E)-2-cyano-3-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)prop-2-enoic acid |
| SMILES | Cc1nc2sccn2c1/C=C(\C#N)C(=O)O |
| InChI | InChI=1S/C10H7N3O2S/c1-6-8(4-7(5-11)9(14)15)13-2-3-16-10(13)12-6/h2-4H,1H3,(H,14,15)/b7-4+ |
| InChIKey | XFIBWJSASLYSMQ-QPJJXVBHSA-N |
| XLogP | 1.70 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|