C6H6N2S2 — CID 142258463
6-methylimidazo[2,1-b][1,3]thiazole-5-thiol (PubChem CID 142258463) has the molecular formula C6H6N2S2 and a molecular weight of 170.26 g/mol. Its IUPAC name is 6-methylimidazo[2,1-b][1,3]thiazole-5-thiol.
| Compound Name | 6-methylimidazo[2,1-b][1,3]thiazole-5-thiol |
|---|---|
| PubChem CID | 142258463 |
| Molecular Formula | C6H6N2S2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 6-methylimidazo[2,1-b][1,3]thiazole-5-thiol |
| SMILES | Cc1nc2sccn2c1S |
| InChI | InChI=1S/C6H6N2S2/c1-4-5(9)8-2-3-10-6(8)7-4/h2-3,9H,1H3 |
| InChIKey | QVLDUDQJRXFJCQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 17.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|